N-Desethyl Sunitinib
N-Desethyl Sunitinib (SU-12662) is a metabolite of sunitinib. Sunitinib is a potent, ATP-competitive VEGFR, PDGFRβ and KIT inhibitor with Ki values of 2, 9, 17, 8 and 4 nM for VEGFR -1, -2, -3, PDGFRβ and KIT, respectively.
| Trivial name | SU-12662 |
| Catalog Number | E7243 |
| Molecular Formula | C5H10N2O3 |
| CAS# | 356068-97-8 |
| Inchi | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1 |
| Inchi Key | ZDXPYRJPNDTMRX-VKHMYHEASA-N |
| SMILES | C(CC(=O)N)C(C(=O)O)N |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/n-desethyl-sunitinib.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7243-n-desethyl-sunitinib-chemical-structure-tube.png |
