Ceramides Mixture
Ceramides Mixture are endogenous long chain, bioactive lipids forming the hydrophobic backbone of complex sphingolipids and are major constituents of the stratum corneum, contributing to the skin’s permeability barrier. They regulate key biological processes such as growth inhibition, cell cycle arrest, telomerase activity modulation, proliferation, apoptosis, and senescence.
Catalog Number | E7200 |
Molecular Formula | C19H16ClNO4 |
CAS# | 100403-19-8 |
Inchi | InChI=1S/C19H16ClNO4/c1-11-15(10-18(22)23)16-9-14(25-2)7-8-17(16)21(11)19(24)12-3-5-13(20)6-4-12/h3-9H,10H2,1-2H3,(H,22,23) |
Inchi Key | CGIGDMFJXJATDK-UHFFFAOYSA-N |
SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)Cl)C=CC(=C2)OC)CC(=O)O |
Size | 25mg |
Supplier Page | http://www.selleckchem.com/products/ceramides-mixture.html |
Additional Information | https://file.selleck.cn/downloads/struct/e7200-ceramides-mixture-chemical-structure-tube.png |