C2 Ceramide
C2 Ceramide (Ceramide 2) is the main lipid of the stratum corneum and a protein phosphatase 1 (PP1) activator. C2 Ceramide activates PP2A and ceramide-activated protein phosphatase (CAPP). C2 Ceramide induces cells differentiation, autophagy and apoptosis, inhibits mitochondrial respiratory chain complex III. C2 Ceramide is also a skin conditioning agent that protects the epidermal barrier from water loss.
| Trivial name | Ceramide 2 |
| Catalog Number | E7153 |
| Molecular Formula | C8H10FN3O3S |
| CAS# | 3102-57-6 |
| Inchi | InChI=1S/C8H10FN3O3S/c9-4-1-12(8(14)11-7(4)10)5-3-16-6(2-13)15-5/h1,5-6,13H,2-3H2,(H2,10,11,14)/t5-,6+/m0/s1 |
| Inchi Key | XQSPYNMVSIKCOC-NTSWFWBYSA-N |
| SMILES | C1C(OC(S1)CO)N2C=C(C(=NC2=O)N)F |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/c2-ceramide.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7153-c2-ceramide-chemical-structure-tube.png |
