Buformin hydrochloride
Buformin hydrochloride (1-Butylbiguanide hydrochloride), a potent AMPK activator, acts as an orally active biguanide antidiabetic agent. Buformin hydrochloride decreases hepatic gluconeogenesis and lowers blood glucose production in vivo. Buformin hydrochloride also has anti-cancer activities and is applied in cancer study (such as, cervical cancer and breast cancer, et al).
| Trivial name | 1-Butylbiguanide hydrochloride |
| Catalog Number | E7112 |
| Molecular Formula | C16H24N10O4 |
| CAS# | 1190-53-0 |
| Inchi | InChI=1S/2C7H8N4O2.C2H8N2/c2*1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h2*3H,1-2H3,(H,8,9);1-4H2 |
| Inchi Key | FQPFAHBPWDRTLU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)NC=N2.CN1C2=C(C(=O)N(C1=O)C)NC=N2.C(CN)N |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/buformin-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7112-buformin-hydrochloride-chemical-structure-tube.png |
