Purpurin 18
Purpurin-18 is a chlorophyll-derived dihydroporphyrin, serves as a key precursor for photosensitizers like purpurinimides, which absorb light in the 700–850 nm range. It demonstrate potent photodynamic anti-tumor activity and generates ROS, disrupting mitochondrial membrane potential and inducing apoptosis against triple-negative breast cancer both in vitro and in vivo.
| Catalog Number | E7081 |
| Molecular Formula | C13H12O2 |
| CAS# | 25465-77-4 |
| Inchi | InChI=1S/C13H12O2/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11/h1-9,14H,10H2 |
| Inchi Key | VYQNWZOUAUKGHI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/purpurin-18.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E7081-Purpurin-18-chemical-structure.png |
