Dalbavancin hydrochloride
Dalbavancin hydrochloride (MDL-63397 hydrochloride) is a semisynthetic lipoglycopeptide antibiotic with potent bactericidal activity against Gram-positive bacteria. Dalbavancin hydrochloride inhibits Staphylococcus aureus and Bacillus anthracis with MIC90s of 0.06 μg/mL and 0.25 μg/mL, respectively.
| Trivial name | MDL-63397 hydrochloride, BI-397 hydrochloride |
| Catalog Number | E6016 |
| Molecular Formula | C10H12FN5O4 |
| CAS# | 2227366-51-8 |
| Inchi | InChI=1S/C10H12FN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)/t3-,5-,6+,9-/m1/s1 |
| Inchi Key | HBUBKKRHXORPQB-FJFJXFQQSA-N |
| SMILES | C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)O)F)N |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/dalbavancin-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e6016-dalbavancin-hydrochloride-chemical-structure-tube.png |
