AkaLumine hydrochloride
AkaLumine hydrochloride is a luciferin analogue, with a Km of 2.06 μM for recombinant firefly luciferase (Fluc) protein. Its near-infrared emission peak enables deep tissue imaging and enhances target-detection sensitivity, allowing more accurate, non-invasive bioluminescence imaging at very low concentrations in animal models.
| Catalog Number | E5964 |
| Molecular Formula | C30H33ClN4O2 |
| CAS# | 2558205-28-8 |
| Inchi | InChI=1S/C30H33ClN4O2/c1-20(2)27(34(17-7-16-32)29(36)23-12-10-21(3)11-13-23)28-33-26-18-24(31)14-15-25(26)30(37)35(28)19-22-8-5-4-6-9-22/h4-6,8-15,18,20,27H,7,16-17,19,32H2,1-3H3/t27-/m1/s1 |
| Inchi Key | QJZRFPJCWMNVAV-HHHXNRCGSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)N(CCCN)C(C2=NC3=C(C=CC(=C3)Cl)C(=O)N2CC4=CC=CC=C4)C(C)C |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/akalumine-hydrochloride.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E5964-AkaLumine-hydrochloride-chemical-structure.png |
