Acetyl phosphate(lithium potassium)
Acetyl phosphate(lithium potassium) is an endogenous metabolite, bypasses the LytS membrane potential sensor by phosphorylating LytR twice as fast, influencing lrgAB operon regulation in glucose-rich conditions without membrane potential disruption. Lithium potassium acetyl phosphate is studied for its electrochemical properties and role in phosphorus chemistry, with potential applications in lithium-ion battery technology and catalytic processes.
Catalog Number | E5841 |
Molecular Formula | C21H17F4N2O7P |
CAS# | 94249-01-1 |
SMILES | CC1=C(OC2=C(C=CC(=C2)C(F)(F)F)C(=O)NC3=CC(=O)N(CO[P](O)(O)=O)C=C3)C=CC(=C1)F |
Size | 5mg |
Supplier Page | http://www.selleckchem.com/products/acetyl-phosphate-lithium-potassium.html |
Additional Information | https://file.selleck.cn/downloads/struct/E5841-Acetyl-phosphate-lithium-potassium-chemical-structure.png |