1-Caffeoylquinic acid
1-Caffeoylquinic acid is an effective NF-κB inhibitor, shows significant binding affinity to the RH domain of p105 with Ki of 0.002 μM and binding energy of 1.50 Kcal/mol. 1-Caffeoylquinic acid has anti-oxidative stress ability. 1-Caffeoylquinic acid inhibits PD-1/PD-L1 interact.
| Catalog Number | E5022 |
| Molecular Formula | C17H11N5 |
| CAS# | 1241-87-8 |
| Inchi | InChI=1S/C17H11N5/c18-9-13-1-5-15(6-2-13)17(22-12-20-11-21-22)16-7-3-14(10-19)4-8-16/h1-8,11-12,17H |
| Inchi Key | HPJKCIUCZWXJDR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(C2=CC=C(C=C2)C#N)N3C=NC=N3 |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/1-caffeoylquinic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e5022-1-caffeoylquinic-acid-chemical-structure-tube.png |
