Zileuton sodium
Zileuton sodium (A 64077 sodium) is a potent, selective, and specific inhibitor of 5-lipoxygenase, exhibiting inflammatory activities. Zileuton sodium prevents polyp formation efficiently by reducing tumor-associated and systemic inflammation in in vivo models. Zileuton sodium also acts as a potential chemo-preventive agent in patients that are at high risk of developing colon cancer.
| Trivial name | A 64077 sodium |
| Catalog Number | E4977 |
| Molecular Formula | C7H15Cl2N2O2P |
| CAS# | 118569-21-4 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | ClCCN(CCCl)[P]1(=O)NCCCO1 |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/zileuton-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4977-Zileuton-sodium-chemical-structure.png |
