Pitolisant
Pitolisant(BF2.649, Tiprolisant) is a potent, selective antagonist of the non-imidazole histamine H3 receptor, with a Ki value of 0.16 nM and an EC50 of 1.5 nM as an inverse agonist. It enhances the activity of histaminergic neurons, promoting vigilance and cognitive function. It is useful in research on wakefulness, memory deficits, and cognitive disorders.
| Trivial name | BF2.649, Tiprolisant |
| Catalog Number | E4955 |
| Molecular Formula | C4H8Na2O6S4 |
| CAS# | 362665-56-3 |
| Inchi | InChI=1S/C4H10O6S4.2Na/c5-13(6,7)3-1-11-12-2-4-14(8,9)10;;/h1-4H2,(H,5,6,7)(H,8,9,10);;/q;2*+1/p-2 |
| Inchi Key | KQYGMURBTJPBPQ-UHFFFAOYSA-L |
| SMILES | C(CS(=O)(=O)[O-])SSCCS(=O)(=O)[O-].[Na+].[Na+] |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/pitolisant.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4955-Pitolisant-chemical-structure.png |