Lefamulin
Lefamulin (BC-3781), is a pleuromutilin antibiotic, inhibits protein synthesis by binding to the peptidyl transferase center of the 50S bacterial ribosome. It is effective against a range of gram-positive pathogens involved in community-acquired bacterial pneumonia (CABP), including Streptococcus pneumoniae, Haemophilus influenzae, Mycoplasma pneumoniae, Legionella pneumophila, Chlamydophila pneumoniae, Staphylococcus aureus (including methicillin-resistant and vancomycin-intermediate strains), and vancomycin-resistant Enterococcus faecium.
| Trivial name | BC-3781 |
| Catalog Number | E4877 |
| Molecular Formula | C20H19N5Na2O6 |
| CAS# | 1061337-51-6 |
| Inchi | InChI=1S/C20H21N5O6.2Na/c21-20-24-16-15(18(29)25-20)12(9-22-16)6-3-10-1-4-11(5-2-10)17(28)23-13(19(30)31)7-8-14(26)27;;/h1-2,4-5,9,13H,3,6-8H2,(H,23,28)(H,26,27)(H,30,31)(H4,21,22,24,25,29);;/q;2*+1/p -2/t13-;;/m0../s1 |
| Inchi Key | NYDXNILOWQXUOF-GXKRWWSZSA-L |
| SMILES | C1=CC(=CC=C1CCC2=CNC3=C2C(=O)NC(=N3)N)C(=O)NC(CCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/lefamulin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4877-Lefamulin-chemical-structure.png |
