Oditrasertib
Oditrasertib (DNL-788, SAR 443820) is a first-in-class, selective, orally bioavailable, brain penetrant inhibitor of Receptor-interacting serine/threonine protein kinase 1 (RIPK1). It can be used in research of myotrophic lateral sclerosis and multiple sclerosis.
| Trivial name | DNL-788,SAR 443820 |
| Catalog Number | E4640 |
| Molecular Formula | C17H17N5O6S |
| CAS# | 2252271-93-3 |
| SMILES | C1=CC(=CC=C1CSC2=NC=NC3=C2N=CN3C4C(C(C(O4)CO)O)O)[N+](=O)[O-] |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/oditrasertib.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4640-Oditrasertib-chemical-structure.png |
