Pyocyanin
Pyocyanin(Pyocyanine; Sanazin; Sanasin) is a redox-active toxin produced by Pseudomonas aeruginosa that generates oxidative stress and selectively harms quorum sensing (QS)-defective mutant bacteria. It acts as a social policing agent, promoting the survival of QS-proficient and more virulent bacterial populations.
| Trivial name | Pyocyanine, Sanazin, Sanasin |
| Catalog Number | E4633 |
| Molecular Formula | C28H29NO6 |
| CAS# | 85-66-5 |
| SMILES | COC1=CC(=CC(=C1)OC)\C=C\C2=CC=C(NC(=O)\C=C\C3=CC(=C(OC)C(=C3)OC)OC)C=C2 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/pyocyanin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4633-Pyocyanin-chemical-structure.png |
