BHPI
BHPI is a potent noncompetitive inhibitor of estrogen receptor α (ERα), which disrupts the protective estrogen–ERα-mediated activation of the unfolded protein response (UPR), leading to sustained UPR activation. It specifically inhibits the growth of drug-resistant ERα-positive breast and ovarian cancer cells and induces significant tumor regression in a mouse xenograft model of breast cancer.
| Catalog Number | E4621 |
| Molecular Formula | C15H13Cl2NO3 |
| CAS# | 56632-39-4 |
| SMILES | C1C2C=CC1C(C2C(=O)NC3=CC(=C(C=C3)Cl)Cl)C(=O)O |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/bhpi.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4621-BHPI-chemical-structure.png |
