SB-743921
SB-743921 (SB-921) is an inhibitor of Kinesin Spindle Protein (KSP), a mitotic protein essential for cell cycle control and motility. It functions by selectively targeting rapidly dividing cells and disrupting spindle formation during cell division, leading to G2/M phase arrest and ultimately causing cell death. It also inhibits proliferation and induces apoptosis in diffuse large B-cell lymphoma (DLBCL) cell lines.
| Trivial name | SB-921 |
| Catalog Number | E4595 |
| Molecular Formula | C16H18FNO2S |
| CAS# | 618430-39-0 |
| SMILES | CCCCC1=CC=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)F |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/sb-743921-sb-921.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e4595-SB-743921-chemical-structure.png |
