9-cis-Retinoic acid
9-cis-Retinoic acid (Alitretinoin, ALRT 1057) is an active metabolite of vitamin A that functions as a high-affinity ligand for retinoid X receptors (RXRs) and also activates retinoic acid receptors (RARs). It inhibits adipogenesis by activating RXR while simultaneously decreasing RXRα and PPARγ levels in an RXR activation-independent manner.
| Trivial name | Alitretinoin, ALRT 1057 |
| Catalog Number | E1695 |
| Molecular Formula | C20H20N4O4 |
| CAS# | 5300-03-8 |
| SMILES | COC1=C(OC)C(=CC(=C1)NC2=NC=C3N=C([N](C)C3=C2)C4=CC=CO4)OC |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/9-cis-retinoic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E1695-9-cis-Retinoic-acid-chemical-structure.png |
