NX-5948
NX-5948(BTK-IN-24) is a novel oral small molecule that induces BTK degradation via cereblon E3 ubiquitin ligase recruitment. It mediates potent anti-inflammatory activity and can cross the blood-brain barrier in animal models.
| Trivial name | BTK-IN-24 |
| Catalog Number | E1660 |
| Molecular Formula | C9H4Cl2O2S |
| CAS# | 2649400-34-8 |
| SMILES | OC(=O)C1=C(Cl)C2=CC=C(Cl)C=C2S1 |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/nx-5948.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E1660-NX-5948-chemical-structure.png |
