AZD8797( KAND567)
AZD8797 (KAND567) is an allosteric, non-competitive, and orally active antagonist of the human receptor CX3CR1. It antagonizes CX3CR1 with a Ki value of 3.9 nM, respectively. It effects G-protein signaling and β-arrestin recruitment.
| Trivial name | KAND567 |
| Catalog Number | E1616 |
| Molecular Formula | C27H23F2N7O3 |
| CAS# | 911715-90-7 |
| SMILES | CC(C)(C)C1=N[N](C(=C1)NC(=O)NC2=CC=C(OC3=C4N=CC(=O)NC4=NC=C3)C=C2F)C5=CC=CC(=C5)F |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/azd8797.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E1616-AZD8797-KAND567-chemical-structure.png |