Difamilast
Difamilast (OPA-15406) is a topical, selective and nonsteroidal phosphodiesterase-4 (PDE4) inhibitor with particularly efficient inhibition of subtype B (IC50=11.2 nM). Difamilast can be used for the research of mild to moderate atopic dermatitis (AD).
| Trivial name | OPA-15406 |
| Catalog Number | E1594 |
| Molecular Formula | C18H19CIFN3O2 |
| CAS# | 937782-05-3 |
| SMILES | COC1=C(C=C(F)C=C1)C2=C(Cl)C=NC(=C2)NC(=O)C3CCCNC3 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/difamilast.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e1594-difamilast-chemical-structure-tube.png |