Voclosporin
Voclosporin is a potent, inhibitor of Calcineurin. It exhibits both immunomodulatory and non-immune effects by inhibiting T-cell proliferation, reducing proteinuria through podocyte cytoskeleton stabilization and afferent arteriole vasoconstriction, and effectively suppressing lymphocyte proliferation and cytokine production, making it useful for systemic lupus erythematosus (SLE) research.
| Trivial name | ISA247, ISATX247 |
| Catalog Number | E1027 |
| Molecular Formula | C31H39N9O6S |
| CAS# | 515814-01-4 |
| SMILES | CC(=O)NCC(=O)NC(CCC(N)=O)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCCNC(N)=N)C(=O)C2=NC3=C(S2)C=CC=C3 |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/voclosporin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E1027-Voclosporin-chemical-structure.png |
