GPR84 antagonist 8
GPR84 antagonist 8 is an antagonist of GPR84,which abrogates the enhanced inflammatory response mediated by 6-OAU. It has the potential to reduce the inflammatory responses associated with the activation of the GPR84 receptor.
| Trivial name | N/A |
| Catalog Number | E0113 |
| Molecular Formula | C10H11N2.I |
| CAS# | 1445846-30-9 |
| SMILES | [I-].C[N+]1=CC=CC2=C(N)C=CC=C12 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/gpr84-antagonist-8.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E0113-GPR84-antagonist-8-chemical-structure.png |
