Benzyl Benzoate (For Injection)
It has been isolated from the plant species of the genus Polyalthia. It has a role as a scabicide, an acaricide and a plant metabolite.
| Catalog Number | PIE-0385 |
| Alternative Name(s) | Ascabiol Benylate Benzoic acid, phenylmethyl ester |
| Research Area | Solubilizer Excipients |
| Molecular Formula | C14H12O2 |
| CAS# | 120-51-4 |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/benzyl-benzoate-for-injection-item-12679.html |