Buspirone Hydrochloride
An anxiolytic agent and serotonin receptor agonist belonging to the azaspirodecanedione class of compounds. Its structure is unrelated to those of the BENZODIAZAPINES, but it has an efficacy comparable to DIAZEPAM.
| Catalog Number | API33386082 |
| Alternative Name(s) | Buspar Buspirone HCL Narol |
| Research Area | Antidepressant APIs |
| Molecular Formula | C21H32ClN5O2 |
| CAS# | 33386-08-2 |
| SMILES | C1CCC2(C1)CC(=O)N(C(=O)C2)CCCCN3CCN(CC3)C4=NC=CC=N4.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/buspirone-hydrochloride-item-12473.html |