Tirofiban Hydrochloride
Tyrosine analog and PLATELET GLYCOPROTEIN GPIIB-IIIA COMPLEX antagonist that inhibits PLATELET AGGREGATION and is used in the treatment of ACUTE CORONARY SYNDROME.
| Catalog Number | API150915405 |
| Alternative Name(s) | Tirofiban hydrochloride monohydrate TIROFIBAN HYDROCHLORIDE Tirofiban HCl Tirofiban hydrochloride hydrate |
| Research Area | Cardiovascular and Geriatric Medicine APIs |
| Molecular Formula | C22H39ClN2O6S |
| CAS# | 150915-40-5 |
| SMILES | CCCCS(=O)(=O)NC(CC1=CC=C(C=C1)OCCCCC2CCNCC2)C(=O)O.O.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/tirofiban-hydrochloride-item-12467.html |