Edoxaban Tosylate
Used for the treatment of deep vein thrombosis and pulmonary embolism. It has a role as an anticoagulant, an EC 3.4.21.6 (coagulation factor Xa) inhibitor and a platelet aggregation inhibitor.
| Catalog Number | API1229194119 |
| Alternative Name(s) | edoxaban tosylate hydrate Edoxaban tosylate monohydrate Lixiana SAVAYSA |
| Research Area | AnticoagulantAntiplatelet APIs |
| Molecular Formula | C31H40ClN7O8S2 |
| CAS# | 1229194-11-9 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CN1CCC2=C(C1)SC(=N2)C(=O)NC3CC(CCC3NC(=O)C(=O)NC4=NC=C(C=C4)Cl)C(=O)N(C)C.O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/edoxaban-tosylate-item-12436.html |