Bedaquiline
Bedaquiline is a bactericidal antimycobacterial drug belonging to the class of diarylquinoline. The quinolinic central heterocyclic nucleus with alcohol and amine side chains is responsible for bedaquiline-mediated antimycobacterial activity.
| Catalog Number | API843663661 |
| Alternative Name(s) | TMC207 TMC-207 R207910 |
| Research Area | Antibacterial APIs |
| Molecular Formula | C32H31BrN2O2 |
| CAS# | 843663-66-1 |
| SMILES | CN(C)CCC(C1=CC=CC2=CC=CC=C21)(C(C3=CC=CC=C3)C4=C(N=C5C=CC(=CC5=C4)Br)OC)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/bedaquiline-item-12246.html |