Diphenhydramine HCl
A histamine H1 antagonist used as an antiemetic, antitussive, for dermatoses and pruritus, for hypersensitivity reactions, as a hypnotic, an antiparkinson, and as an ingredient in common cold preparations. It has some undesired antimuscarinic and sedative effects.
| Catalog Number | API147240 |
| Alternative Name(s) | DIPHENHYDRAMINE HYDROCHLORIDE Dimedrol Allergival |
| Research Area | AntiemeticEmetic APIs |
| Molecular Formula | C17H21NO.ClH |
| CAS# | 147-24-0 |
| SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/diphenhydramine-hcl-item-12220.html |