Fexuprazan/Abeprazan
Abeprazan inhibits H+, K+- ATPase by reversible potassium-competitive ionic binding with no acid activation required. Abeprazan is used for the treatment of 5-HT receptor or muscarinic acetylcholine receptor-mediated diseases.
| Catalog Number | API1902954602 |
| Alternative Name(s) | Fexuprazan DWP14012 BE52S2C1QT |
| Research Area | Inhibit Gastric Acid Secretion APIs |
| Molecular Formula | C19H17F3N2O3S |
| CAS# | 1902954-60-2 |
| SMILES | CNCC1=CN(C(=C1OC)C2=C(C=C(C=C2)F)F)S(=O)(=O)C3=CC=CC(=C3)F |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/fexuprazanabeprazan-item-12211.html |