7-ACA
7beta-aminocephalosporanic acid is the alpha,beta-unsaturated monocarboxylic acid that is the active nucleus for the synthesis of cephalosporins and intermediates. It is functionally related to a cephalosporanic acid. It is a tautomer of a 7beta-aminocephalosporanic acid zwitterion.
| Catalog Number | INT957686 |
| Alternative Name(s) | 7-Aminocephalosporanic acid 7-Aminocephalosporinic acid 7-ACS |
| Research Area | Intermediates |
| Molecular Formula | C10H12N2O5S |
| CAS# | 957-68-6 |
| SMILES | CC(=O)OCC1=C(N2C(C(C2=O)N)SC1)C(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/7-aca-item-12085.html |