Olapali Intermediate 3
2-fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzoic acid is an impurity of olaparib, which selectively binds and inhibits PARP, inhibiting PARP-mediated repair of single-strand DNA breaks.
| Catalog Number | INT763114267 |
| Alternative Name(s) | 2-Fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzoic acid 2-fluoro-5-[(4-oxo-3,4-dihydrophthalazin-1-yl)methyl]benzoic acid 2-Fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid Benzoic acid, 5-[(3,4-dihydro-4-oxo-1-phthalazinyl)methyl]-2-fluoro- |
| Research Area | Intermediates |
| Molecular Formula | C16H11FN2O3 |
| CAS# | 763114-26-7 |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)CC3=CC(=C(C=C3)F)C(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/olapali-intermediate-3-item-12063.html |