Atazanavir Base
Atazanavir is a heavily substituted carbohydrazide that is an antiretroviral drug of the protease inhibitor (PI) class used to treat infection of human immunodeficiency virus (HIV). It has a role as an antiviral drug and a HIV protease inhibitor.
| Catalog Number | INT198904313 |
| Alternative Name(s) | Atazanavir Latazanavir Zrivada Reyataz |
| Research Area | Intermediates |
| Molecular Formula | C38H52N6O7 |
| CAS# | 198904-31-3 |
| SMILES | CC(C)(C)C(C(=O)NC(CC1=CC=CC=C1)C(CN(CC2=CC=C(C=C2)C3=CC=CC=N3)NC(=O)C(C(C)(C)C)NC(=O)OC)O)NC(=O)OC |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/atazanavir-base-item-12058.html |