Dinotefuran
Venom is a concentrated fluid of poisonous and biologically active substances secreted by a variety of animals that can be injected or in some other way introduced into another animal or human, usually by a bite or a sting.
| Catalog Number | API165252700 |
| Alternative Name(s) | 1-Methyl-2-nitro-3-((tetrahydrofuran-3-yl)methyl)guanidine 1-methyl-2-nitro-3-((3-tetrahydrofuryl)methyl)guanidine 1-methyl-2-nitro-3-(tetrahydrofuran-3-ylmethyl)guanidine |
| Research Area | Active Pharmaceutical Ingredients |
| Molecular Formula | C7H14N4O3 |
| CAS# | 165252-70-0 |
| SMILES | CNC(=N[N+](=O)[O-])NCC1CCOC1 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dinotefuran-item-11939.html |