Closantel Sodium
Closantel is a salicylaniline anthelmintic, which exhibits a different anthelmintic spectrum and obvious toxicity in mammals. Closamide sodium is widely used in various infections of the above-mentioned parasitic diseases in cattle and sheep.
| Catalog Number | API61438640 |
| Alternative Name(s) | Closantel sodium Closantel (sodium) 0ZBS9YC04P |
| Research Area | Active Pharmaceutical Ingredients |
| Molecular Formula | C22H13Cl2I2N2NaO2 |
| CAS# | 61438-64-0 |
| SMILES | CC1=CC(=C(C=C1NC(=O)C2=C(C(=CC(=C2)I)I)[O-])Cl)C(C#N)C3=CC=C(C=C3)Cl.[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/closantel-sodium-item-11933.html |