Edoxaban
Edoxaban is a monocarboxylic acid amide that is used (as its tosylate monohydrate) for the treatment of deep vein thrombosis and pulmonary embolism. It has a role as an anticoagulant, an EC 3.4.21.6 (coagulation factor Xa) inhibitor and a platelet aggregation inhibitor.
| Catalog Number | API480449705 |
| Alternative Name(s) | DU-176 UNII-NDU3J18APO |
| Research Area | AnticoagulantAntiplatelet APIs |
| Molecular Formula | C24H30ClN7O4S |
| CAS# | 480449-70-5 |
| SMILES | CN1CCC2=C(C1)SC(=N2)C(=O)NC3CC(CCC3NC(=O)C(=O)NC4=NC=C(C=C4)Cl)C(=O)N(C)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/edoxaban-item-11912.html |