Bedaquiline
Bedaquiline Fumarate is the fumarate salt form of bedaquiline, an orally bioavailable diarylquinoline antimycobacterial agent, that can be used in the treatment of pulmonary multi-drug resistant tuberculosis (MDR-TB).
| Catalog Number | API845533860 |
| Alternative Name(s) | Bedaquiline (fumarate) Sirturo R403323 |
| Research Area | Antibacterial APIs |
| Molecular Formula | C36H35BrN2O6 |
| CAS# | 845533-86-0 |
| SMILES | CN(C)CCC(C1=CC=CC2=CC=CC=C21)(C(C3=CC=CC=C3)C4=C(N=C5C=CC(=CC5=C4)Br)OC)O.C(=CC(=O)O)C(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/bedaquiline-item-11874.html |