NADH
NADH becomes oxidized to produce NAD+, NAD usually acts as a hydrogen acceptor, forming NADH which then serves as a hydrogen donor in the respiratory chain.
Nutritional supplement in health care products.
| Catalog Number | API606688 |
| Alternative Name(s) | Disodium nicotinamide adenine dinucleotide NADH (disodium salt) NADH disodium salt |
| Research Area | NutritionHealthcare APIs |
| Molecular Formula | C21H27N7Na2O14P2 |
| CAS# | 606-68-8 |
| SMILES | C1C=CN(C=C1C(=O)N)C2C(C(C(O2)COP(=O)([O-])OP(=O)([O-])OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O.[Na+].[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/nadh-item-11846.html |