NAD
It is found widely in nature and is involved in numerous enzymatic reactions in which it serves as an electron carrier by being alternately oxidized (NAD+) and reduced (NADH).
| Catalog Number | API53849 |
| Alternative Name(s) | nadide NAD+ beta-nicotinamide adenine dinucleotide coenzyme I |
| Research Area | NutritionHealthcare APIs |
| Molecular Formula | C21H27N7O14P2 |
| CAS# | 53-84-9 |
| SMILES | C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)O)O)O)O)C(=O)N |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/nad-item-11844.html |