Lovastatin
It is used in as an anticholesteremic drug and has been found in fungal species such as Aspergillus terreus and Pleurotus ostreatus (oyster mushroom). It has a role as an Aspergillus metabolite, a prodrug, an anticholesteremic drug and an antineoplastic agent.
| Catalog Number | API75330755 |
| Alternative Name(s) | mevinolin Lovalip Mevacor |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C24H36O5 |
| CAS# | 75330-75-5 |
| SMILES | CCC(C)C(=O)OC1CC(C=C2C1C(C(C=C2)C)CCC3CC(CC(=O)O3)O)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/lovastatin-item-11830.html |