Lidocaine Hydrochloride
A local anesthetic and cardiac depressant used as an antiarrhythmia agent. Its actions are more intense and its effects more prolonged than those of PROCAINE but its duration of action is shorter than that of BUPIVACAINE or PRILOCAINE.
| Catalog Number | API6108050 |
| Alternative Name(s) | Lidocaine hydrochloride monohydrate Zingo Linocaine hydrochloride Lignocaine hydrochloride |
| Research Area | Antiarrhythmic APIs |
| Molecular Formula | C14H25ClN2O2 |
| CAS# | 6108-05-0 |
| SMILES | CCN(CC)CC(=O)NC1=C(C=CC=C1C)C.O.Cl |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/lidocaine-hydrochloride-item-11782.html |