Dasatinib
A multi-targeted kinase inhibitor, it is used, particularly as the monohydrate, for the treatment of chronic, accelerated, or myeloid or lymphoid blast phase chronic myeloid leukemia.
| Catalog Number | API302962498 |
| Alternative Name(s) | Sprycel BMS-354825 Dasatinib anhydrous |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C22H26ClN7O2S |
| CAS# | 302962-49-8 |
| SMILES | CC1=C(C(=CC=C1)Cl)NC(=O)C2=CN=C(S2)NC3=CC(=NC(=N3)C)N4CCN(CC4)CCO |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/dasatinib-item-11765.html |