Tegafur
Tegafur is a congener of the antimetabolite fluorouracil with antineoplastic activity. Tegafur is a prodrug that is gradually converted to fluorouracil in the liver by the cytochrome P-450 enzyme.
| Catalog Number | API17902237 |
| Alternative Name(s) | Ftorafur Futraful Sinoflurol |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C8H9FN2O3 |
| CAS# | 17902-23-7 |
| SMILES | C1CC(OC1)N2C=C(C(=O)NC2=O)F |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/tegafur-item-11734.html |