Reduced Glutathione
A tripeptide with many roles in cells. It conjugates to drugs to make them more soluble for excretion, is a cofactor for some enzymes, is involved in protein disulfide bond rearrangement and reduces peroxides.
| Catalog Number | PIPB-0757 |
| Alternative Name(s) | L-Glutathione Glutathion L-Glutathione reduced |
| Research Area | ProteinsBiomaterials |
| Molecular Formula | C10H17N3O6S |
| CAS# | 70-18-8 |
| SMILES | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/reduced-glutathione-item-11679.html |