Piroxicam
A cyclooxygenase inhibiting, non-steroidal anti-inflammatory agent (NSAID) that is well established in treating rheumatoid arthritis and osteoarthritis and used for musculoskeletal disorders, dysmenorrhea, and postoperative pain. Its long half-life enables it to be administered once daily.
| Catalog Number | API36322904 |
| Alternative Name(s) | Feldene Piroxicamum Pyroxycam |
| Research Area | Nonsteroidal Anti-inflammatory (NSAID) APIs |
| Molecular Formula | C15H13N3O4S |
| CAS# | 36322-90-4 |
| SMILES | CN1C(=C(C2=CC=CC=C2S1(=O)=O)O)C(=O)NC3=CC=CC=N3 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/piroxicam-item-11644.html |