Fmoc-Gly-OH
Fmoc-Gly-OH is an N-Fmoc-protected form of Glycine. Glycine is a non-essential amino acid that acts as an inhibitory neyrotransmitter in the vertebrate central nervous system. Glycine also posesses cytoprotective effect against oxidant damage in the kidney.
| Catalog Number | PIPB-0723 |
| Alternative Name(s) | Fmoc-glycine N-[(9H-Fluoren-9-ylmethoxy)carbonyl]glycine N-Fmoc-glycine |
| Research Area | Peptide |
| Molecular Formula | C17H15NO4 |
| CAS# | 29022-11-5 |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/fmoc-gly-oh-item-11500.html |