Fulvestrant intermediate N-1
S-Deoxo Fulvestrant is a derivative of Fulvestrant, an estrogen receptor antagonist used as a medication indicated for the treatment of hormone receptor (HR)-positive metastatic breast cancer in postmenopausal women.
| Catalog Number | INT153004310 |
| Alternative Name(s) | (7R,8R,9S,13S,14S,17S)-13-Methyl-7-(9-((4,4,5,5,5-pentafluoropentyl)thio)nonyl)-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,17-diol S-Deoxo Fulvestrant (7a,17b)-7-[9-[(4,4,5,5,5-Pentafluoropentyl)thio]nonyl]-estra-1,3,5(10)-triene-3,17-diol |
| Research Area | Intermediates |
| Molecular Formula | C32H47F5O2S |
| CAS# | 153004-31-0 |
| SMILES | CC12CCC3C(C1CCC2O)C(CC4=C3C=CC(=C4)O)CCCCCCCCCSCCCC(C(F)(F)F)(F)F |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/fulvestrant-intermediate-n-1-item-11425.html |