8DM/16α-methyl epoxide
Dexamethasone EP Impurity D is a compound extracted from patent CN 106520896 A and RU 2532902 C1. It is an intermediate in the preparation of dexamethasone.
| Catalog Number | INT24916903 |
| Alternative Name(s) | Dexamethasone 9,11-Epoxide 16-Alpha-Methylepoxide 45O198JS6W 9beta,11beta-Epoxy-17,21-dihydroxy-16alpha-methylpregna-1,4-diene-3,20-dione |
| Research Area | Intermediates |
| Molecular Formula | C22H28O5 |
| CAS# | 24916-90-3 |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C35C(O5)CC2(C1(C(=O)CO)O)C)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/8dm16-methyl-epoxide-item-11407.html |