Teprenone
It has a role as an anti-ulcer drug, a cardioprotective agent, a hepatoprotective agent, a nephroprotective agent, a neuroprotective agent and a Hsp70 inducer. It is a methyl ketone and a terpene ketone. It contains a geranylgeranyl group.
| Catalog Number | API6809525 |
| Alternative Name(s) | teprenone Geranylgeranylacetone Tetraprenylacetone Selbex |
| Research Area | Gastrointes Tinal Agents APIs |
| Molecular Formula | C23H38O |
| CAS# | 6809-52-5 |
| SMILES | CC(=CCCC(=CCCC(=CCCC(=CCCC(=O)C)C)C)C)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/teprenone-item-11359.html |