Nandrolone decanoate
Nandrolone Decanoate is the decanoate salt form of nandrolone, an anabolic steroid analog of testosterone with androgenic, anabolic, and erythropoietin stimulating effects. Nandrolone enters the cell and binds to and activates specific nuclear androgen receptors in responsive tissue, including the prostate, seminal vesicles, scrotum, penis, larynx, hair follicles, muscle, and bone. The resulting activated hormone receptor complex translocates into the nucleus and binds to androgen response elements (ARE) in the promoter region of targeted genes, where the complex promotes gene expression necessary for maintaining male sex characteristics.
Catalog Number | API360703 |
Alternative Name(s) | Retabolil Retabolyl Nortestosterone decanoate |
Research Area | APIs for Androgens |
Molecular Formula | C28H44O3 |
CAS# | 360-70-3 |
SMILES | CCCCCCCCCC(=O)OC1CCC2C1(CCC3C2CCC4=CC(=O)CCC34)C |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/nandrolone-decanoate-item-11336.html |