Cyproterone acetate
It is an antiandrogenic drug which has recently been recognized to promote the occurrence and growth of intracranial meningiomas. It has a role as an androgen antagonist, a progestin and a geroprotector.
| Catalog Number | API427510 |
| Alternative Name(s) | Androcur Cyproteroneacetate Cyproterone 17-O-acetate |
| Research Area | APIs for Progestogens |
| Molecular Formula | C24H29ClO4 |
| CAS# | 427-51-0 |
| SMILES | CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(=O)C5CC5C34C)Cl)C)OC(=O)C |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/cyproterone-acetate-item-11330.html |